C31H34N8O3 — CID 169232733
6-(5-methoxy-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169232733) has the molecular formula C31H34N8O3 and a molecular weight of 566.67 g/mol. Its IUPAC name is 6-(5-methoxy-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(5-methoxy-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169232733 |
| Molecular Formula | C31H34N8O3 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 6-(5-methoxy-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CCN(c2cc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc3n(C)c2=O)c2cccc(OC)c21 |
| InChI | InChI=1S/C31H34N8O3/c1-5-27(40)39-18-17-38(24-7-6-8-26(42-4)28(24)39)25-19-21-20-32-31(34-29(21)36(3)30(25)41)33-22-9-11-23(12-10-22)37-15-13-35(2)14-16-37/h5-12,19-20H,1,13-18H2,2-4H3,(H,32,33,34) |
| InChIKey | FIPNKKQBHUOBSH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|