C29H34N8O — CID 169232477
8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-phenylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169232477) has the molecular formula C29H34N8O and a molecular weight of 510.65 g/mol. Its IUPAC name is 8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-phenylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-phenylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169232477 |
| Molecular Formula | C29H34N8O |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-phenylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc(N5CCNCC5c5ccccc5)c(=O)n(C)c4n3)cc2)CC1 |
| InChI | InChI=1S/C29H34N8O/c1-34-14-16-36(17-15-34)24-10-8-23(9-11-24)32-29-31-19-22-18-25(28(38)35(2)27(22)33-29)37-13-12-30-20-26(37)21-6-4-3-5-7-21/h3-11,18-19,26,30H,12-17,20H2,1-2H3,(H,31,32,33) |
| InChIKey | VBTQVGLEHZHYFZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|