C34H38N8O3 — CID 169232525
8-(3-hydroxycyclobutyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169232525) has the molecular formula C34H38N8O3 and a molecular weight of 606.73 g/mol. Its IUPAC name is 8-(3-hydroxycyclobutyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(3-hydroxycyclobutyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169232525 |
| Molecular Formula | C34H38N8O3 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | 8-(3-hydroxycyclobutyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-4-prop-2-enoyl-2,3-dihydroquinoxalin-1-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CCN(c2cc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc3n(C3CC(O)C3)c2=O)c2cccc(C)c21 |
| InChI | InChI=1S/C34H38N8O3/c1-4-30(44)41-17-16-40(28-7-5-6-22(2)31(28)41)29-18-23-21-35-34(37-32(23)42(33(29)45)26-19-27(43)20-26)36-24-8-10-25(11-9-24)39-14-12-38(3)13-15-39/h4-11,18,21,26-27,43H,1,12-17,19-20H2,2-3H3,(H,35,36,37) |
| InChIKey | RSMIXAASCCCBAL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|