C28H26FN7 — CID 165389459
6-(2-fluoro-6-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,6]naphthyridin-2-amine (PubChem CID 165389459) has the molecular formula C28H26FN7 and a molecular weight of 479.56 g/mol. Its IUPAC name is 6-(2-fluoro-6-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,6]naphthyridin-2-amine.
| Compound Name | 6-(2-fluoro-6-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,6]naphthyridin-2-amine |
|---|---|
| PubChem CID | 165389459 |
| Molecular Formula | C28H26FN7 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 6-(2-fluoro-6-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,6]naphthyridin-2-amine |
| SMILES | Cc1cccc(F)c1-c1nc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2c2cnccc12 |
| InChI | InChI=1S/C28H26FN7/c1-18-4-3-5-23(29)25(18)27-21-10-11-30-16-22(21)26-24(33-27)17-31-28(34-26)32-19-6-8-20(9-7-19)36-14-12-35(2)13-15-36/h3-11,16-17H,12-15H2,1-2H3,(H,31,32,34) |
| InChIKey | NVBRFLVMZFBOJD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|