C26H38N6 — CID 161342534
6-(3-methylbutyl)-7-pentan-3-yl-N-(4-piperazin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 161342534) has the molecular formula C26H38N6 and a molecular weight of 434.63 g/mol. Its IUPAC name is 6-(3-methylbutyl)-7-pentan-3-yl-N-(4-piperazin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-(3-methylbutyl)-7-pentan-3-yl-N-(4-piperazin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 161342534 |
| Molecular Formula | C26H38N6 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | 6-(3-methylbutyl)-7-pentan-3-yl-N-(4-piperazin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCC(CC)n1c(CCC(C)C)cc2cnc(Nc3ccc(N4CCNCC4)cc3)nc21 |
| InChI | InChI=1S/C26H38N6/c1-5-22(6-2)32-24(10-7-19(3)4)17-20-18-28-26(30-25(20)32)29-21-8-11-23(12-9-21)31-15-13-27-14-16-31/h8-9,11-12,17-19,22,27H,5-7,10,13-16H2,1-4H3,(H,28,29,30) |
| InChIKey | VMWAXUWWAGUYNA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|