C24H31N7O2 — CID 10138745
5-cyclopentyl-3-(4-piperazin-1-ylanilino)-7-propoxypyrido[2,3-e][1,2,4]triazin-6-one (PubChem CID 10138745) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 5-cyclopentyl-3-(4-piperazin-1-ylanilino)-7-propoxypyrido[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 5-cyclopentyl-3-(4-piperazin-1-ylanilino)-7-propoxypyrido[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 10138745 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 5-cyclopentyl-3-(4-piperazin-1-ylanilino)-7-propoxypyrido[2,3-e][1,2,4]triazin-6-one |
| SMILES | CCCOc1cc2nnc(Nc3ccc(N4CCNCC4)cc3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C24H31N7O2/c1-2-15-33-21-16-20-22(31(23(21)32)19-5-3-4-6-19)27-24(29-28-20)26-17-7-9-18(10-8-17)30-13-11-25-12-14-30/h7-10,16,19,25H,2-6,11-15H2,1H3,(H,26,27,29) |
| InChIKey | UYFRDOSSNYUPIJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|