C24H31N4O3P — CID 175240498
8-cyclopentyl-2-[4-(diethylphosphoryloxymethyl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 175240498) has the molecular formula C24H31N4O3P and a molecular weight of 454.51 g/mol. Its IUPAC name is 8-cyclopentyl-2-[4-(diethylphosphoryloxymethyl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-[4-(diethylphosphoryloxymethyl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 175240498 |
| Molecular Formula | C24H31N4O3P |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 8-cyclopentyl-2-[4-(diethylphosphoryloxymethyl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCP(=O)(CC)OCc1ccc(Nc2ncc3c(C)cc(=O)n(C4CCCC4)c3n2)cc1 |
| InChI | InChI=1S/C24H31N4O3P/c1-4-32(30,5-2)31-16-18-10-12-19(13-11-18)26-24-25-15-21-17(3)14-22(29)28(23(21)27-24)20-8-6-7-9-20/h10-15,20H,4-9,16H2,1-3H3,(H,25,26,27) |
| InChIKey | QHDOMXNNICNFTG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|