C23H23ClN8O — CID 145360582
8-(4-aminophenyl)-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pteridin-7-one (PubChem CID 145360582) has the molecular formula C23H23ClN8O and a molecular weight of 462.95 g/mol. Its IUPAC name is 8-(4-aminophenyl)-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pteridin-7-one.
| Compound Name | 8-(4-aminophenyl)-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pteridin-7-one |
|---|---|
| PubChem CID | 145360582 |
| Molecular Formula | C23H23ClN8O |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 8-(4-aminophenyl)-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pteridin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ncc(=O)n(-c5ccc(N)cc5)c4n3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H23ClN8O/c1-30-8-10-31(11-9-30)20-7-4-16(12-18(20)24)28-23-27-13-19-22(29-23)32(21(33)14-26-19)17-5-2-15(25)3-6-17/h2-7,12-14H,8-11,25H2,1H3,(H,27,28,29) |
| InChIKey | PZSIGYYNTBEPTC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|