C26H27F3N8O2 — CID 134444914
2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-8-[3-(methylamino)phenyl]-6-(trifluoromethyl)pteridin-7-one (PubChem CID 134444914) has the molecular formula C26H27F3N8O2 and a molecular weight of 540.55 g/mol. Its IUPAC name is 2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-8-[3-(methylamino)phenyl]-6-(trifluoromethyl)pteridin-7-one.
| Compound Name | 2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-8-[3-(methylamino)phenyl]-6-(trifluoromethyl)pteridin-7-one |
|---|---|
| PubChem CID | 134444914 |
| Molecular Formula | C26H27F3N8O2 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-8-[3-(methylamino)phenyl]-6-(trifluoromethyl)pteridin-7-one |
| SMILES | CNc1cccc(-n2c(=O)c(C(F)(F)F)nc3cnc(Nc4ccc(N5CCN(C)CC5)c(OC)c4)nc32)c1 |
| InChI | InChI=1S/C26H27F3N8O2/c1-30-16-5-4-6-18(13-16)37-23-19(33-22(24(37)38)26(27,28)29)15-31-25(34-23)32-17-7-8-20(21(14-17)39-3)36-11-9-35(2)10-12-36/h4-8,13-15,30H,9-12H2,1-3H3,(H,31,32,34) |
| InChIKey | LFHOSJWJPSVZCV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|