C26H33N5O5 — CID 157420400
2-[5-[2-(2-hydroxyethoxy)acetyl]-2-methylanilino]-4-[[2-(2-oxobut-3-enyl)cyclohexyl]amino]pyrimidine-5-carboxamide (PubChem CID 157420400) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[5-[2-(2-hydroxyethoxy)acetyl]-2-methylanilino]-4-[[2-(2-oxobut-3-enyl)cyclohexyl]amino]pyrimidine-5-carboxamide.
| Compound Name | 2-[5-[2-(2-hydroxyethoxy)acetyl]-2-methylanilino]-4-[[2-(2-oxobut-3-enyl)cyclohexyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 157420400 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-[5-[2-(2-hydroxyethoxy)acetyl]-2-methylanilino]-4-[[2-(2-oxobut-3-enyl)cyclohexyl]amino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)CC1CCCCC1Nc1nc(Nc2cc(C(=O)COCCO)ccc2C)ncc1C(N)=O |
| InChI | InChI=1S/C26H33N5O5/c1-3-19(33)12-17-6-4-5-7-21(17)29-25-20(24(27)35)14-28-26(31-25)30-22-13-18(9-8-16(22)2)23(34)15-36-11-10-32/h3,8-9,13-14,17,21,32H,1,4-7,10-12,15H2,2H3,(H2,27,35)(H2,28,29,30,31) |
| InChIKey | BPIJVAHCZAMLBI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|