C24H29ClN6O2 — CID 126549387
3-[[5-chloro-4-[[(1S,2S)-4-cyclobutyl-2-(prop-2-enoylamino)cyclopentyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide (PubChem CID 126549387) has the molecular formula C24H29ClN6O2 and a molecular weight of 468.99 g/mol. Its IUPAC name is 3-[[5-chloro-4-[[(1S,2S)-4-cyclobutyl-2-(prop-2-enoylamino)cyclopentyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide.
| Compound Name | 3-[[5-chloro-4-[[(1S,2S)-4-cyclobutyl-2-(prop-2-enoylamino)cyclopentyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 126549387 |
| Molecular Formula | C24H29ClN6O2 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3-[[5-chloro-4-[[(1S,2S)-4-cyclobutyl-2-(prop-2-enoylamino)cyclopentyl]amino]pyrimidin-2-yl]amino]-4-methylbenzamide |
| SMILES | C=CC(=O)N[C@H]1CC(C2CCC2)C[C@@H]1Nc1nc(Nc2cc(C(N)=O)ccc2C)ncc1Cl |
| InChI | InChI=1S/C24H29ClN6O2/c1-3-21(32)28-19-10-16(14-5-4-6-14)11-20(19)29-23-17(25)12-27-24(31-23)30-18-9-15(22(26)33)8-7-13(18)2/h3,7-9,12,14,16,19-20H,1,4-6,10-11H2,2H3,(H2,26,33)(H,28,32)(H2,27,29,30,31)/t16?,19-,20-/m0/s1 |
| InChIKey | OLDPVTXQQSQTJI-RFFXKOPCSA-N |
| XLogP | 3.94 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|