C17H21N7O2S — CID 144808737
2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide (PubChem CID 144808737) has the molecular formula C17H21N7O2S and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 144808737 |
| Molecular Formula | C17H21N7O2S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)N1CCCC(Nc2nc(Nc3cc(C)ns3)ncc2C(N)=O)C1 |
| InChI | InChI=1S/C17H21N7O2S/c1-3-14(25)24-6-4-5-11(9-24)20-16-12(15(18)26)8-19-17(22-16)21-13-7-10(2)23-27-13/h3,7-8,11H,1,4-6,9H2,2H3,(H2,18,26)(H2,19,20,21,22) |
| InChIKey | BOYDNGXWSAQUCT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|