C22H22ClN5O2 — CID 118967160
N-[2-[[5-chloro-2-[5-(hydroxymethyl)-2-methylanilino]pyrimidin-4-yl]amino]phenyl]-2-methylprop-2-enamide (PubChem CID 118967160) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-[5-(hydroxymethyl)-2-methylanilino]pyrimidin-4-yl]amino]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[[5-chloro-2-[5-(hydroxymethyl)-2-methylanilino]pyrimidin-4-yl]amino]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 118967160 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[2-[[5-chloro-2-[5-(hydroxymethyl)-2-methylanilino]pyrimidin-4-yl]amino]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccccc1Nc1nc(Nc2cc(CO)ccc2C)ncc1Cl |
| InChI | InChI=1S/C22H22ClN5O2/c1-13(2)21(30)26-18-7-5-4-6-17(18)25-20-16(23)11-24-22(28-20)27-19-10-15(12-29)9-8-14(19)3/h4-11,29H,1,12H2,2-3H3,(H,26,30)(H2,24,25,27,28) |
| InChIKey | ABNUQJLHMHWIEQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|