C19H20ClN5OS — CID 170011866
[4-[[5-chloro-4-[2-(dimethylaminosulfanyl)anilino]pyrimidin-2-yl]amino]phenyl]methanol (PubChem CID 170011866) has the molecular formula C19H20ClN5OS and a molecular weight of 401.92 g/mol. Its IUPAC name is [4-[[5-chloro-4-[2-(dimethylaminosulfanyl)anilino]pyrimidin-2-yl]amino]phenyl]methanol.
| Compound Name | [4-[[5-chloro-4-[2-(dimethylaminosulfanyl)anilino]pyrimidin-2-yl]amino]phenyl]methanol |
|---|---|
| PubChem CID | 170011866 |
| Molecular Formula | C19H20ClN5OS |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [4-[[5-chloro-4-[2-(dimethylaminosulfanyl)anilino]pyrimidin-2-yl]amino]phenyl]methanol |
| SMILES | CN(C)Sc1ccccc1Nc1nc(Nc2ccc(CO)cc2)ncc1Cl |
| InChI | InChI=1S/C19H20ClN5OS/c1-25(2)27-17-6-4-3-5-16(17)23-18-15(20)11-21-19(24-18)22-14-9-7-13(12-26)8-10-14/h3-11,26H,12H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | FAYQPUHJKHCWQR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|