C24H30ClN7S — CID 155582828
5-chloro-4-N-[2-(dimethylaminosulfanyl)phenyl]-2-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine (PubChem CID 155582828) has the molecular formula C24H30ClN7S and a molecular weight of 484.07 g/mol. Its IUPAC name is 5-chloro-4-N-[2-(dimethylaminosulfanyl)phenyl]-2-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-[2-(dimethylaminosulfanyl)phenyl]-2-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155582828 |
| Molecular Formula | C24H30ClN7S |
| Molecular Weight | 484.07 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 5-chloro-4-N-[2-(dimethylaminosulfanyl)phenyl]-2-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(Cc2ccc(Nc3ncc(Cl)c(Nc4ccccc4SN(C)C)n3)cc2)CC1 |
| InChI | InChI=1S/C24H30ClN7S/c1-30(2)33-22-7-5-4-6-21(22)28-23-20(25)16-26-24(29-23)27-19-10-8-18(9-11-19)17-32-14-12-31(3)13-15-32/h4-11,16H,12-15,17H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | AODQXQLKTUWIRC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.07 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|