C24H31ClN7O2S+ — CID 155761909
[5-chloro-2-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]-[2-(dimethylsulfamoyl)phenyl]azanium (PubChem CID 155761909) has the molecular formula C24H31ClN7O2S+ and a molecular weight of 517.08 g/mol. Its IUPAC name is [5-chloro-2-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]-[2-(dimethylsulfamoyl)phenyl]azanium.
| Compound Name | [5-chloro-2-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]-[2-(dimethylsulfamoyl)phenyl]azanium |
|---|---|
| PubChem CID | 155761909 |
| Molecular Formula | C24H31ClN7O2S+ |
| Molecular Weight | 517.08 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [5-chloro-2-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]-[2-(dimethylsulfamoyl)phenyl]azanium |
| SMILES | CN1CCN(Cc2ccc(Nc3ncc(Cl)c([NH2+]c4ccccc4S(=O)(=O)N(C)C)n3)cc2)CC1 |
| InChI | InChI=1S/C24H30ClN7O2S/c1-30(2)35(33,34)22-7-5-4-6-21(22)28-23-20(25)16-26-24(29-23)27-19-10-8-18(9-11-19)17-32-14-12-31(3)13-15-32/h4-11,16H,12-15,17H2,1-3H3,(H2,26,27,28,29)/p+1 |
| InChIKey | YUAALFPUEOYPNX-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.08 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|