C25H28Cl2IN7O2S — CID 149454669
5-chloro-4-N-(4-chloro-2-pyrrolidin-1-ylsulfonylphenyl)-2-N-[4-[(4-iodopiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine (PubChem CID 149454669) has the molecular formula C25H28Cl2IN7O2S and a molecular weight of 688.42 g/mol. Its IUPAC name is 5-chloro-4-N-(4-chloro-2-pyrrolidin-1-ylsulfonylphenyl)-2-N-[4-[(4-iodopiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(4-chloro-2-pyrrolidin-1-ylsulfonylphenyl)-2-N-[4-[(4-iodopiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 149454669 |
| Molecular Formula | C25H28Cl2IN7O2S |
| Molecular Weight | 688.42 g/mol |
| Exact Mass | 687.04 |
| IUPAC Name | 5-chloro-4-N-(4-chloro-2-pyrrolidin-1-ylsulfonylphenyl)-2-N-[4-[(4-iodopiperazin-1-yl)methyl]phenyl]pyrimidine-2,4-diamine |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Nc1nc(Nc2ccc(CN3CCN(I)CC3)cc2)ncc1Cl)N1CCCC1 |
| InChI | InChI=1S/C25H28Cl2IN7O2S/c26-19-5-8-22(23(15-19)38(36,37)35-9-1-2-10-35)31-24-21(27)16-29-25(32-24)30-20-6-3-18(4-7-20)17-33-11-13-34(28)14-12-33/h3-8,15-16H,1-2,9-14,17H2,(H2,29,30,31,32) |
| InChIKey | YYHRRAZAQKYKHL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|