C20H21ClN8O2 — CID 123483383
N-[3-[[[2-[[1-(3-amino-2-oxopropyl)pyrazol-4-yl]amino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 123483383) has the molecular formula C20H21ClN8O2 and a molecular weight of 440.90 g/mol. Its IUPAC name is N-[3-[[[2-[[1-(3-amino-2-oxopropyl)pyrazol-4-yl]amino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[2-[[1-(3-amino-2-oxopropyl)pyrazol-4-yl]amino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123483383 |
| Molecular Formula | C20H21ClN8O2 |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[3-[[[2-[[1-(3-amino-2-oxopropyl)pyrazol-4-yl]amino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3cnn(CC(=O)CN)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C20H21ClN8O2/c1-2-18(31)26-14-5-3-4-13(6-14)8-23-19-17(21)10-24-20(28-19)27-15-9-25-29(11-15)12-16(30)7-22/h2-6,9-11H,1,7-8,12,22H2,(H,26,31)(H2,23,24,27,28) |
| InChIKey | SBXCNHVBUAYFNV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 139.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|