C22H31ClN6O — CID 118475753
N-[3-[[[5-chloro-2-[4-(diethylamino)butylamino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 118475753) has the molecular formula C22H31ClN6O and a molecular weight of 430.98 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-[4-(diethylamino)butylamino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[5-chloro-2-[4-(diethylamino)butylamino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118475753 |
| Molecular Formula | C22H31ClN6O |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-[3-[[[5-chloro-2-[4-(diethylamino)butylamino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(NCCCCN(CC)CC)ncc2Cl)c1 |
| InChI | InChI=1S/C22H31ClN6O/c1-4-20(30)27-18-11-9-10-17(14-18)15-25-21-19(23)16-26-22(28-21)24-12-7-8-13-29(5-2)6-3/h4,9-11,14,16H,1,5-8,12-13,15H2,2-3H3,(H,27,30)(H2,24,25,26,28) |
| InChIKey | NZGJREKJSINXBY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|