C21H24ClN6O2+ — CID 123805449
N-[3-[[[5-chloro-2-[[1-(1-hydroxy-2-methylpropan-2-yl)-2H-azet-1-ium-3-ylidene]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 123805449) has the molecular formula C21H24ClN6O2+ and a molecular weight of 427.92 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-[[1-(1-hydroxy-2-methylpropan-2-yl)-2H-azet-1-ium-3-ylidene]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[5-chloro-2-[[1-(1-hydroxy-2-methylpropan-2-yl)-2H-azet-1-ium-3-ylidene]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123805449 |
| Molecular Formula | C21H24ClN6O2+ |
| Molecular Weight | 427.92 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[3-[[[5-chloro-2-[[1-(1-hydroxy-2-methylpropan-2-yl)-2H-azet-1-ium-3-ylidene]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(N=C3C=[N+](C(C)(C)CO)C3)ncc2Cl)c1 |
| InChI | InChI=1S/C21H23ClN6O2/c1-4-18(30)25-15-7-5-6-14(8-15)9-23-19-17(22)10-24-20(27-19)26-16-11-28(12-16)21(2,3)13-29/h4-8,10-11,29H,1,9,12-13H2,2-3H3,(H-,23,24,25,27,30)/p+1 |
| InChIKey | OCDQJARGWWXNEJ-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.92 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|