C23H23FIN5O — CID 144952668
N-[3-[[[2-(3-fluoro-4-propylanilino)-5-iodopyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 144952668) has the molecular formula C23H23FIN5O and a molecular weight of 531.37 g/mol. Its IUPAC name is N-[3-[[[2-(3-fluoro-4-propylanilino)-5-iodopyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[2-(3-fluoro-4-propylanilino)-5-iodopyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144952668 |
| Molecular Formula | C23H23FIN5O |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | N-[3-[[[2-(3-fluoro-4-propylanilino)-5-iodopyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3ccc(CCC)c(F)c3)ncc2I)c1 |
| InChI | InChI=1S/C23H23FIN5O/c1-3-6-16-9-10-18(12-19(16)24)29-23-27-14-20(25)22(30-23)26-13-15-7-5-8-17(11-15)28-21(31)4-2/h4-5,7-12,14H,2-3,6,13H2,1H3,(H,28,31)(H2,26,27,29,30) |
| InChIKey | XDAGFNGWIKXGBK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|