C23H38N4O — CID 144952657
ethane;N-[3-[[(2,5,6-trimethylpyrimidin-4-yl)amino]methyl]phenyl]prop-2-enamide (PubChem CID 144952657) has the molecular formula C23H38N4O and a molecular weight of 386.58 g/mol. Its IUPAC name is ethane;N-[3-[[(2,5,6-trimethylpyrimidin-4-yl)amino]methyl]phenyl]prop-2-enamide.
| Compound Name | ethane;N-[3-[[(2,5,6-trimethylpyrimidin-4-yl)amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144952657 |
| Molecular Formula | C23H38N4O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | ethane;N-[3-[[(2,5,6-trimethylpyrimidin-4-yl)amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(C)nc(C)c2C)c1.CC.CC.CC |
| InChI | InChI=1S/C17H20N4O.3C2H6/c1-5-16(22)21-15-8-6-7-14(9-15)10-18-17-11(2)12(3)19-13(4)20-17;3*1-2/h5-9H,1,10H2,2-4H3,(H,21,22)(H,18,19,20);3*1-2H3 |
| InChIKey | UUEDUHBNPIVRNB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|