C18H15ClFN5O — CID 163209589
2-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzamide (PubChem CID 163209589) has the molecular formula C18H15ClFN5O and a molecular weight of 371.80 g/mol. Its IUPAC name is 2-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzamide.
| Compound Name | 2-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 163209589 |
| Molecular Formula | C18H15ClFN5O |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1ncc(Cl)c(NCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H15ClFN5O/c19-14-10-23-18(24-15-7-2-1-6-13(15)16(21)26)25-17(14)22-9-11-4-3-5-12(20)8-11/h1-8,10H,9H2,(H2,21,26)(H2,22,23,24,25) |
| InChIKey | LTFJLUGPEUNYQB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |