C21H17ClFN5O — CID 118141236
1-[4-(benzylamino)-5-chloropyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide (PubChem CID 118141236) has the molecular formula C21H17ClFN5O and a molecular weight of 409.85 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5-chloropyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-5-chloropyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide |
|---|---|
| PubChem CID | 118141236 |
| Molecular Formula | C21H17ClFN5O |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-[4-(benzylamino)-5-chloropyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide |
| SMILES | Cc1cc2c(C(N)=O)cc(F)cc2n1-c1ncc(Cl)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C21H17ClFN5O/c1-12-7-15-16(19(24)29)8-14(23)9-18(15)28(12)21-26-11-17(22)20(27-21)25-10-13-5-3-2-4-6-13/h2-9,11H,10H2,1H3,(H2,24,29)(H,25,26,27) |
| InChIKey | KFLCLPRATBHGJI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |