C23H22FN5O — CID 118141378
1-[4-(benzylamino)-5-ethylpyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide (PubChem CID 118141378) has the molecular formula C23H22FN5O and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5-ethylpyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-5-ethylpyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide |
|---|---|
| PubChem CID | 118141378 |
| Molecular Formula | C23H22FN5O |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[4-(benzylamino)-5-ethylpyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide |
| SMILES | CCc1cnc(-n2c(C)cc3c(C(N)=O)cc(F)cc32)nc1NCc1ccccc1 |
| InChI | InChI=1S/C23H22FN5O/c1-3-16-13-27-23(28-22(16)26-12-15-7-5-4-6-8-15)29-14(2)9-18-19(21(25)30)10-17(24)11-20(18)29/h4-11,13H,3,12H2,1-2H3,(H2,25,30)(H,26,27,28) |
| InChIKey | XSUNZTBMWNHKEM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |