C22H21FN6O — CID 118141106
1-[5-(aminomethyl)-4-(benzylamino)pyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide (PubChem CID 118141106) has the molecular formula C22H21FN6O and a molecular weight of 404.45 g/mol. Its IUPAC name is 1-[5-(aminomethyl)-4-(benzylamino)pyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide.
| Compound Name | 1-[5-(aminomethyl)-4-(benzylamino)pyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide |
|---|---|
| PubChem CID | 118141106 |
| Molecular Formula | C22H21FN6O |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[5-(aminomethyl)-4-(benzylamino)pyrimidin-2-yl]-6-fluoro-2-methylindole-4-carboxamide |
| SMILES | Cc1cc2c(C(N)=O)cc(F)cc2n1-c1ncc(CN)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C22H21FN6O/c1-13-7-17-18(20(25)30)8-16(23)9-19(17)29(13)22-27-12-15(10-24)21(28-22)26-11-14-5-3-2-4-6-14/h2-9,12H,10-11,24H2,1H3,(H2,25,30)(H,26,27,28) |
| InChIKey | ONCCAUKYTAJWSF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |