C26H28N6O — CID 118141179
1-[4-(benzylamino)-5-piperidin-4-ylpyrimidin-2-yl]-2-methylindole-4-carboxamide (PubChem CID 118141179) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5-piperidin-4-ylpyrimidin-2-yl]-2-methylindole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-5-piperidin-4-ylpyrimidin-2-yl]-2-methylindole-4-carboxamide |
|---|---|
| PubChem CID | 118141179 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[4-(benzylamino)-5-piperidin-4-ylpyrimidin-2-yl]-2-methylindole-4-carboxamide |
| SMILES | Cc1cc2c(C(N)=O)cccc2n1-c1ncc(C2CCNCC2)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C26H28N6O/c1-17-14-21-20(24(27)33)8-5-9-23(21)32(17)26-30-16-22(19-10-12-28-13-11-19)25(31-26)29-15-18-6-3-2-4-7-18/h2-9,14,16,19,28H,10-13,15H2,1H3,(H2,27,33)(H,29,30,31) |
| InChIKey | REIQXMAUZQDMDS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |