C28H30N6O — CID 130423782
1-[4-(benzylamino)-6,8,9,10,11,11a-hexahydro-5H-pyrimido[4,5-a]quinolizin-2-yl]-2-methylindole-4-carboxamide (PubChem CID 130423782) has the molecular formula C28H30N6O and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-[4-(benzylamino)-6,8,9,10,11,11a-hexahydro-5H-pyrimido[4,5-a]quinolizin-2-yl]-2-methylindole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-6,8,9,10,11,11a-hexahydro-5H-pyrimido[4,5-a]quinolizin-2-yl]-2-methylindole-4-carboxamide |
|---|---|
| PubChem CID | 130423782 |
| Molecular Formula | C28H30N6O |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[4-(benzylamino)-6,8,9,10,11,11a-hexahydro-5H-pyrimido[4,5-a]quinolizin-2-yl]-2-methylindole-4-carboxamide |
| SMILES | Cc1cc2c(C(N)=O)cccc2n1-c1nc(NCc2ccccc2)c2c(n1)C1CCCCN1CC2 |
| InChI | InChI=1S/C28H30N6O/c1-18-16-22-20(26(29)35)10-7-12-23(22)34(18)28-31-25-21(13-15-33-14-6-5-11-24(25)33)27(32-28)30-17-19-8-3-2-4-9-19/h2-4,7-10,12,16,24H,5-6,11,13-15,17H2,1H3,(H2,29,35)(H,30,31,32) |
| InChIKey | KSRULSJCIAJKJT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |