C25H26BN5O3 — CID 145205620
[3-[[[2-(4-carbamoyl-2-methylindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205620) has the molecular formula C25H26BN5O3 and a molecular weight of 455.33 g/mol. Its IUPAC name is [3-[[[2-(4-carbamoyl-2-methylindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(4-carbamoyl-2-methylindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205620 |
| Molecular Formula | C25H26BN5O3 |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [3-[[[2-(4-carbamoyl-2-methylindol-1-yl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | Cc1cc2c(C(N)=O)cccc2n1-c1nc2c(c(NCc3cccc(B(O)O)c3)n1)CCCC2 |
| InChI | InChI=1S/C25H26BN5O3/c1-15-12-20-18(23(27)32)9-5-11-22(20)31(15)25-29-21-10-3-2-8-19(21)24(30-25)28-14-16-6-4-7-17(13-16)26(33)34/h4-7,9,11-13,33-34H,2-3,8,10,14H2,1H3,(H2,27,32)(H,28,29,30) |
| InChIKey | GPTOLIAWBBVNHM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|