C22H24BN7O3 — CID 140755856
[3-[[[4-(4-carbamoyl-2-methylindol-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]boronic acid (PubChem CID 140755856) has the molecular formula C22H24BN7O3 and a molecular weight of 445.29 g/mol. Its IUPAC name is [3-[[[4-(4-carbamoyl-2-methylindol-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[4-(4-carbamoyl-2-methylindol-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140755856 |
| Molecular Formula | C22H24BN7O3 |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [3-[[[4-(4-carbamoyl-2-methylindol-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]boronic acid |
| SMILES | Cc1cc2c(C(N)=O)cccc2n1-c1nc(NCc2cccc(B(O)O)c2)nc(N(C)C)n1 |
| InChI | InChI=1S/C22H24BN7O3/c1-13-10-17-16(19(24)31)8-5-9-18(17)30(13)22-27-20(26-21(28-22)29(2)3)25-12-14-6-4-7-15(11-14)23(32)33/h4-11,32-33H,12H2,1-3H3,(H2,24,31)(H,25,26,27,28) |
| InChIKey | UNVRLIBWWJTXSU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|