C23H26BN7O3 — CID 145206221
[3-[[[2-[2-(aminomethyl)-4-carbamoylindol-1-yl]-5-(dimethylamino)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145206221) has the molecular formula C23H26BN7O3 and a molecular weight of 459.32 g/mol. Its IUPAC name is [3-[[[2-[2-(aminomethyl)-4-carbamoylindol-1-yl]-5-(dimethylamino)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-[2-(aminomethyl)-4-carbamoylindol-1-yl]-5-(dimethylamino)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145206221 |
| Molecular Formula | C23H26BN7O3 |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [3-[[[2-[2-(aminomethyl)-4-carbamoylindol-1-yl]-5-(dimethylamino)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | CN(C)c1cnc(-n2c(CN)cc3c(C(N)=O)cccc32)nc1NCc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C23H26BN7O3/c1-30(2)20-13-28-23(29-22(20)27-12-14-5-3-6-15(9-14)24(33)34)31-16(11-25)10-18-17(21(26)32)7-4-8-19(18)31/h3-10,13,33-34H,11-12,25H2,1-2H3,(H2,26,32)(H,27,28,29) |
| InChIKey | RWOBYSARDMLREM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 155.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|