C22H23N7O2 — CID 118141224
1-[4-(benzylamino)-5-(dimethylamino)pyrimidin-2-yl]-2-methoxybenzimidazole-4-carboxamide (PubChem CID 118141224) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5-(dimethylamino)pyrimidin-2-yl]-2-methoxybenzimidazole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-5-(dimethylamino)pyrimidin-2-yl]-2-methoxybenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 118141224 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-[4-(benzylamino)-5-(dimethylamino)pyrimidin-2-yl]-2-methoxybenzimidazole-4-carboxamide |
| SMILES | COc1nc2c(C(N)=O)cccc2n1-c1ncc(N(C)C)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C22H23N7O2/c1-28(2)17-13-25-21(27-20(17)24-12-14-8-5-4-6-9-14)29-16-11-7-10-15(19(23)30)18(16)26-22(29)31-3/h4-11,13H,12H2,1-3H3,(H2,23,30)(H,24,25,27) |
| InChIKey | QYGGYPJELKDALU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |