C23H24N7O3+ — CID 175062219
1-[4-(benzylamino)-6,7,8,9-tetrahydro-[1,2,4]triazino[6,1-b][1,3]oxazepin-10-ium-2-yl]-2-methoxybenzimidazole-4-carboxamide (PubChem CID 175062219) has the molecular formula C23H24N7O3+ and a molecular weight of 446.49 g/mol. Its IUPAC name is 1-[4-(benzylamino)-6,7,8,9-tetrahydro-[1,2,4]triazino[6,1-b][1,3]oxazepin-10-ium-2-yl]-2-methoxybenzimidazole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-6,7,8,9-tetrahydro-[1,2,4]triazino[6,1-b][1,3]oxazepin-10-ium-2-yl]-2-methoxybenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 175062219 |
| Molecular Formula | C23H24N7O3+ |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[4-(benzylamino)-6,7,8,9-tetrahydro-[1,2,4]triazino[6,1-b][1,3]oxazepin-10-ium-2-yl]-2-methoxybenzimidazole-4-carboxamide |
| SMILES | COc1nc2c(C(N)=O)cccc2n1-c1nc(NCc2ccccc2)c2[n+](n1)CCCCO2 |
| InChI | InChI=1S/C23H23N7O3/c1-32-23-26-18-16(19(24)31)10-7-11-17(18)30(23)22-27-20(25-14-15-8-3-2-4-9-15)21-29(28-22)12-5-6-13-33-21/h2-4,7-11H,5-6,12-14H2,1H3,(H2-,24,25,27,28,31)/p+1 |
| InChIKey | DOMPAWUSBLHRED-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|