C22H23BN6O4 — CID 145205890
[3-[[[2-(4-carbamoyl-2-methoxybenzimidazol-1-yl)-5,6-dimethylpyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205890) has the molecular formula C22H23BN6O4 and a molecular weight of 446.28 g/mol. Its IUPAC name is [3-[[[2-(4-carbamoyl-2-methoxybenzimidazol-1-yl)-5,6-dimethylpyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(4-carbamoyl-2-methoxybenzimidazol-1-yl)-5,6-dimethylpyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205890 |
| Molecular Formula | C22H23BN6O4 |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [3-[[[2-(4-carbamoyl-2-methoxybenzimidazol-1-yl)-5,6-dimethylpyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | COc1nc2c(C(N)=O)cccc2n1-c1nc(C)c(C)c(NCc2cccc(B(O)O)c2)n1 |
| InChI | InChI=1S/C22H23BN6O4/c1-12-13(2)26-21(28-20(12)25-11-14-6-4-7-15(10-14)23(31)32)29-17-9-5-8-16(19(24)30)18(17)27-22(29)33-3/h4-10,31-32H,11H2,1-3H3,(H2,24,30)(H,25,26,28) |
| InChIKey | ZCTIXRRDSQOIDG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|