C24H23BN8O4 — CID 145205528
[3-[[[8-(2-aminoethoxy)-2-(4-carbamoylbenzotriazol-1-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205528) has the molecular formula C24H23BN8O4 and a molecular weight of 498.31 g/mol. Its IUPAC name is [3-[[[8-(2-aminoethoxy)-2-(4-carbamoylbenzotriazol-1-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[8-(2-aminoethoxy)-2-(4-carbamoylbenzotriazol-1-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205528 |
| Molecular Formula | C24H23BN8O4 |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [3-[[[8-(2-aminoethoxy)-2-(4-carbamoylbenzotriazol-1-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | NCCOc1cccc2c(NCc3cccc(B(O)O)c3)nc(-n3nnc4c(C(N)=O)cccc43)nc12 |
| InChI | InChI=1S/C24H23BN8O4/c26-10-11-37-19-9-3-7-17-21(19)29-24(33-18-8-2-6-16(22(27)34)20(18)31-32-33)30-23(17)28-13-14-4-1-5-15(12-14)25(35)36/h1-9,12,35-36H,10-11,13,26H2,(H2,27,34)(H,28,29,30) |
| InChIKey | ZAJOBNYTHLPWSY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 187.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|