C21H20BN5O3 — CID 145206207
[3-[[[2-(4-carbamoyl-2-methylisoindol-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145206207) has the molecular formula C21H20BN5O3 and a molecular weight of 401.24 g/mol. Its IUPAC name is [3-[[[2-(4-carbamoyl-2-methylisoindol-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(4-carbamoyl-2-methylisoindol-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145206207 |
| Molecular Formula | C21H20BN5O3 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [3-[[[2-(4-carbamoyl-2-methylisoindol-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | Cn1cc2c(C(N)=O)cccc2c1-c1nccc(NCc2cccc(B(O)O)c2)n1 |
| InChI | InChI=1S/C21H20BN5O3/c1-27-12-17-15(6-3-7-16(17)20(23)28)19(27)21-24-9-8-18(26-21)25-11-13-4-2-5-14(10-13)22(29)30/h2-10,12,29-30H,11H2,1H3,(H2,23,28)(H,24,25,26) |
| InChIKey | XYXXCMAQDRWVKV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|