C18H16BN7O3 — CID 145205562
[3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205562) has the molecular formula C18H16BN7O3 and a molecular weight of 389.18 g/mol. Its IUPAC name is [3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205562 |
| Molecular Formula | C18H16BN7O3 |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | NC(=O)c1cccn2c(-c3nccc(NCc4cccc(B(O)O)c4)n3)nnc12 |
| InChI | InChI=1S/C18H16BN7O3/c20-15(27)13-5-2-8-26-17(13)24-25-18(26)16-21-7-6-14(23-16)22-10-11-3-1-4-12(9-11)19(28)29/h1-9,28-29H,10H2,(H2,20,27)(H,21,22,23) |
| InChIKey | WGBAOMKWCWMGNF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|