C20H19BN6O3 — CID 140755500
[3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid (PubChem CID 140755500) has the molecular formula C20H19BN6O3 and a molecular weight of 402.22 g/mol. Its IUPAC name is [3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140755500 |
| Molecular Formula | C20H19BN6O3 |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
| SMILES | Cc1cc2c(C(N)=O)cccn2c1-c1nncc(NCc2cccc(B(O)O)c2)n1 |
| InChI | InChI=1S/C20H19BN6O3/c1-12-8-16-15(19(22)28)6-3-7-27(16)18(12)20-25-17(11-24-26-20)23-10-13-4-2-5-14(9-13)21(29)30/h2-9,11,29-30H,10H2,1H3,(H2,22,28)(H,23,25,26) |
| InChIKey | YWBRAXOWCNKLTC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|