C21H21BN6O3 — CID 140755592
[3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-6-methyl-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid (PubChem CID 140755592) has the molecular formula C21H21BN6O3 and a molecular weight of 416.25 g/mol. Its IUPAC name is [3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-6-methyl-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-6-methyl-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140755592 |
| Molecular Formula | C21H21BN6O3 |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [3-[[[3-(8-carbamoyl-2-methylindolizin-3-yl)-6-methyl-1,2,4-triazin-5-yl]amino]methyl]phenyl]boronic acid |
| SMILES | Cc1cc2c(C(N)=O)cccn2c1-c1nnc(C)c(NCc2cccc(B(O)O)c2)n1 |
| InChI | InChI=1S/C21H21BN6O3/c1-12-9-17-16(19(23)29)7-4-8-28(17)18(12)21-25-20(13(2)26-27-21)24-11-14-5-3-6-15(10-14)22(30)31/h3-10,30-31H,11H2,1-2H3,(H2,23,29)(H,24,25,27) |
| InChIKey | AQOBZYJIIBEKJY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|