C20H18BN7O4 — CID 145205158
[3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205158) has the molecular formula C20H18BN7O4 and a molecular weight of 431.22 g/mol. Its IUPAC name is [3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205158 |
| Molecular Formula | C20H18BN7O4 |
| Molecular Weight | 431.22 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [3-[[[2-(8-carbamoyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | NC(=O)c1cccn2c(-c3nc4c(c(NCc5cccc(B(O)O)c5)n3)OCC4)nnc12 |
| InChI | InChI=1S/C20H18BN7O4/c22-16(29)13-5-2-7-28-19(13)26-27-20(28)18-24-14-6-8-32-15(14)17(25-18)23-10-11-3-1-4-12(9-11)21(30)31/h1-5,7,9,30-31H,6,8,10H2,(H2,22,29)(H,23,24,25) |
| InChIKey | UOJQLUJVZRUJRL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|