C21H19BFN5O3 — CID 145205343
[2-(4-carbamoyl-2-methylisoindol-1-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid (PubChem CID 145205343) has the molecular formula C21H19BFN5O3 and a molecular weight of 419.23 g/mol. Its IUPAC name is [2-(4-carbamoyl-2-methylisoindol-1-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid.
| Compound Name | [2-(4-carbamoyl-2-methylisoindol-1-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 145205343 |
| Molecular Formula | C21H19BFN5O3 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [2-(4-carbamoyl-2-methylisoindol-1-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid |
| SMILES | Cn1cc2c(C(N)=O)cccc2c1-c1ncc(B(O)O)c(NCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H19BFN5O3/c1-28-11-16-14(6-3-7-15(16)19(24)29)18(28)21-26-10-17(22(30)31)20(27-21)25-9-12-4-2-5-13(23)8-12/h2-8,10-11,30-31H,9H2,1H3,(H2,24,29)(H,25,26,27) |
| InChIKey | XUIUPZYQTKUQLY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|