C18H15BFN7O3 — CID 145205668
[2-(7-carbamoyltriazolo[1,5-a]pyridin-3-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid (PubChem CID 145205668) has the molecular formula C18H15BFN7O3 and a molecular weight of 407.17 g/mol. Its IUPAC name is [2-(7-carbamoyltriazolo[1,5-a]pyridin-3-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid.
| Compound Name | [2-(7-carbamoyltriazolo[1,5-a]pyridin-3-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 145205668 |
| Molecular Formula | C18H15BFN7O3 |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [2-(7-carbamoyltriazolo[1,5-a]pyridin-3-yl)-4-[(3-fluorophenyl)methylamino]pyrimidin-5-yl]boronic acid |
| SMILES | NC(=O)c1cccc2c(-c3ncc(B(O)O)c(NCc4cccc(F)c4)n3)nnn12 |
| InChI | InChI=1S/C18H15BFN7O3/c20-11-4-1-3-10(7-11)8-22-17-12(19(29)30)9-23-18(24-17)15-13-5-2-6-14(16(21)28)27(13)26-25-15/h1-7,9,29-30H,8H2,(H2,21,28)(H,22,23,24) |
| InChIKey | WRFVBVREUQJURV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|