C22H21BN4O5 — CID 145205342
[3-[[[2-(7-carbamoyl-2-methyl-1-benzofuran-3-yl)-5-methoxypyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205342) has the molecular formula C22H21BN4O5 and a molecular weight of 432.25 g/mol. Its IUPAC name is [3-[[[2-(7-carbamoyl-2-methyl-1-benzofuran-3-yl)-5-methoxypyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-(7-carbamoyl-2-methyl-1-benzofuran-3-yl)-5-methoxypyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205342 |
| Molecular Formula | C22H21BN4O5 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [3-[[[2-(7-carbamoyl-2-methyl-1-benzofuran-3-yl)-5-methoxypyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | COc1cnc(-c2c(C)oc3c(C(N)=O)cccc23)nc1NCc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C22H21BN4O5/c1-12-18(15-7-4-8-16(20(24)28)19(15)32-12)22-26-11-17(31-2)21(27-22)25-10-13-5-3-6-14(9-13)23(29)30/h3-9,11,29-30H,10H2,1-2H3,(H2,24,28)(H,25,26,27) |
| InChIKey | CDJHBYUFCUZJHM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|