C27H27BN6O4 — CID 145205198
[3-[[[8-(2-aminoethoxy)-2-(7-carbamoyl-2-methyl-1H-indol-3-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 145205198) has the molecular formula C27H27BN6O4 and a molecular weight of 510.36 g/mol. Its IUPAC name is [3-[[[8-(2-aminoethoxy)-2-(7-carbamoyl-2-methyl-1H-indol-3-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[8-(2-aminoethoxy)-2-(7-carbamoyl-2-methyl-1H-indol-3-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145205198 |
| Molecular Formula | C27H27BN6O4 |
| Molecular Weight | 510.36 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | [3-[[[8-(2-aminoethoxy)-2-(7-carbamoyl-2-methyl-1H-indol-3-yl)quinazolin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | Cc1[nH]c2c(C(N)=O)cccc2c1-c1nc(NCc2cccc(B(O)O)c2)c2cccc(OCCN)c2n1 |
| InChI | InChI=1S/C27H27BN6O4/c1-15-22(18-7-3-8-19(25(30)35)23(18)32-15)27-33-24-20(9-4-10-21(24)38-12-11-29)26(34-27)31-14-16-5-2-6-17(13-16)28(36)37/h2-10,13,32,36-37H,11-12,14,29H2,1H3,(H2,30,35)(H,31,33,34) |
| InChIKey | VAMDDUPYYLIVPT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|