C29H30N4O2 — CID 118331929
N-benzyl-8-(2-methoxyethoxy)-2-(2-propan-2-ylindol-1-yl)quinazolin-4-amine (PubChem CID 118331929) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-benzyl-8-(2-methoxyethoxy)-2-(2-propan-2-ylindol-1-yl)quinazolin-4-amine.
| Compound Name | N-benzyl-8-(2-methoxyethoxy)-2-(2-propan-2-ylindol-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 118331929 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-benzyl-8-(2-methoxyethoxy)-2-(2-propan-2-ylindol-1-yl)quinazolin-4-amine |
| SMILES | COCCOc1cccc2c(NCc3ccccc3)nc(-n3c(C(C)C)cc4ccccc43)nc12 |
| InChI | InChI=1S/C29H30N4O2/c1-20(2)25-18-22-12-7-8-14-24(22)33(25)29-31-27-23(13-9-15-26(27)35-17-16-34-3)28(32-29)30-19-21-10-5-4-6-11-21/h4-15,18,20H,16-17,19H2,1-3H3,(H,30,31,32) |
| InChIKey | PDAWRQPCHZWAMD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|