About 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine
5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine (PubChem CID 71489821) has the molecular formula C17H19N5O
and a molecular weight of 309.37 g/mol. Its IUPAC name is 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine.
Molecular Properties
| Compound Name | 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine |
| PubChem CID | 71489821 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine |
| SMILES | COCCNc1nnc(NCc2ccccc2)c2cccnc12 |
| InChI | InChI=1S/C17H19N5O/c1-23-11-10-19-17-15-14(8-5-9-18-15)16(21-22-17)20-12-13-6-3-2-4-7-13/h2-9H,10-12H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | JUNRQYBXLSPLAL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine?
The IUPAC name of 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine (CID 71489821) is 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine.
What is the SMILES notation for 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine?
The canonical SMILES for 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine is COCCNc1nnc(NCc2ccccc2)c2cccnc12.
What is the InChIKey of 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine?
The InChIKey is JUNRQYBXLSPLAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O/c1-23-11-10-19-17-15-14(8-5-9-18-15)16(21-22-17)20-12-13-6-3-2-4-7-13/h2-9H,10-12H2,1H3,(H,19,22)(H,20,21).
What are the key properties of 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine?
5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine has a molecular weight of 309.37 g/mol, XLogP of 2.70, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-benzyl-8-N-(2-methoxyethyl)pyrido[2,3-d]pyridazine-5,8-diamine is sourced from PubChem (CID 71489821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).