C14H11N4Se — CID 56969500
CID 56969500 (PubChem CID 56969500) has the molecular formula C14H11N4Se and a molecular weight of 314.23 g/mol.
| Compound Name | CID 56969500 |
|---|---|
| PubChem CID | 56969500 |
| Molecular Formula | C14H11N4Se |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | — |
| SMILES | [Se]c1nc(NCc2ccccc2)c2cccnc2n1 |
| InChI | InChI=1S/C14H11N4Se/c19-14-17-12-11(7-4-8-15-12)13(18-14)16-9-10-5-2-1-3-6-10/h1-8H,9H2,(H,15,16,17,18) |
| InChIKey | RMMCZKWGVLOWEU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|