C25H20N8O — CID 58523902
2-(2-aminobenzimidazol-1-yl)-N-benzyl-10-methoxypyrimido[5,4-b][1,8]naphthyridin-4-amine (PubChem CID 58523902) has the molecular formula C25H20N8O and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-(2-aminobenzimidazol-1-yl)-N-benzyl-10-methoxypyrimido[5,4-b][1,8]naphthyridin-4-amine.
| Compound Name | 2-(2-aminobenzimidazol-1-yl)-N-benzyl-10-methoxypyrimido[5,4-b][1,8]naphthyridin-4-amine |
|---|---|
| PubChem CID | 58523902 |
| Molecular Formula | C25H20N8O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-(2-aminobenzimidazol-1-yl)-N-benzyl-10-methoxypyrimido[5,4-b][1,8]naphthyridin-4-amine |
| SMILES | COc1c2cccnc2nc2c(NCc3ccccc3)nc(-n3c(N)nc4ccccc43)nc12 |
| InChI | InChI=1S/C25H20N8O/c1-34-21-16-10-7-13-27-22(16)30-20-19(21)31-25(32-23(20)28-14-15-8-3-2-4-9-15)33-18-12-6-5-11-17(18)29-24(33)26/h2-13H,14H2,1H3,(H2,26,29)(H,28,31,32) |
| InChIKey | FZHSJHRRRCHSGY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|