C15H12N8 — CID 23535624
1-[4-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]benzimidazol-2-amine (PubChem CID 23535624) has the molecular formula C15H12N8 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[4-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]benzimidazol-2-amine.
| Compound Name | 1-[4-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 23535624 |
| Molecular Formula | C15H12N8 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[4-(pyridin-2-ylamino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
| SMILES | Nc1nc2ccccc2n1-c1ncnc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C15H12N8/c16-13-20-10-5-1-2-6-11(10)23(13)15-19-9-18-14(22-15)21-12-7-3-4-8-17-12/h1-9H,(H2,16,20)(H,17,18,19,21,22) |
| InChIKey | LTKSYIZSWOGNDU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |