C8H8N6 — CID 15184533
2-N-pyridin-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 15184533) has the molecular formula C8H8N6 and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-N-pyridin-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-pyridin-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15184533 |
| Molecular Formula | C8H8N6 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-N-pyridin-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C8H8N6/c9-7-11-5-12-8(14-7)13-6-3-1-2-4-10-6/h1-5H,(H3,9,10,11,12,13,14) |
| InChIKey | CJKZGRNNKBTZOM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |